About 1,3-di(propan-2-yl)benzene;phenyl cyanate
1,3-di(propan-2-yl)benzene;phenyl cyanate (PubChem CID 159209579) has the molecular formula C19H23NO
and a molecular weight of 281.40 g/mol. Its IUPAC name is 1,3-di(propan-2-yl)benzene;phenyl cyanate.
Molecular Properties
| Compound Name | 1,3-di(propan-2-yl)benzene;phenyl cyanate |
| PubChem CID | 159209579 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1,3-di(propan-2-yl)benzene;phenyl cyanate |
| SMILES | CC(C)c1cccc(C(C)C)c1.N#COc1ccccc1 |
| InChI | InChI=1S/C12H18.C7H5NO/c1-9(2)11-6-5-7-12(8-11)10(3)4;8-6-9-7-4-2-1-3-5-7/h5-10H,1-4H3;1-5H |
| InChIKey | KQHZLCLWOYYXTQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,3-di(propan-2-yl)benzene;phenyl cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-di(propan-2-yl)benzene;phenyl cyanate?
The IUPAC name of 1,3-di(propan-2-yl)benzene;phenyl cyanate (CID 159209579) is 1,3-di(propan-2-yl)benzene;phenyl cyanate.
What is the SMILES notation for 1,3-di(propan-2-yl)benzene;phenyl cyanate?
The canonical SMILES for 1,3-di(propan-2-yl)benzene;phenyl cyanate is CC(C)c1cccc(C(C)C)c1.N#COc1ccccc1.
What is the InChIKey of 1,3-di(propan-2-yl)benzene;phenyl cyanate?
The InChIKey is KQHZLCLWOYYXTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C7H5NO/c1-9(2)11-6-5-7-12(8-11)10(3)4;8-6-9-7-4-2-1-3-5-7/h5-10H,1-4H3;1-5H.
What are the key properties of 1,3-di(propan-2-yl)benzene;phenyl cyanate?
1,3-di(propan-2-yl)benzene;phenyl cyanate has a molecular weight of 281.40 g/mol, XLogP of 5.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-di(propan-2-yl)benzene;phenyl cyanate is sourced from PubChem (CID 159209579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).