C28H19N3O2 — CID 157095796
[4-[3-(4-cyanatophenyl)-2-phenyl-1,2-dihydroindol-3-yl]phenyl] cyanate (PubChem CID 157095796) has the molecular formula C28H19N3O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is [4-[3-(4-cyanatophenyl)-2-phenyl-1,2-dihydroindol-3-yl]phenyl] cyanate.
| Compound Name | [4-[3-(4-cyanatophenyl)-2-phenyl-1,2-dihydroindol-3-yl]phenyl] cyanate |
|---|---|
| PubChem CID | 157095796 |
| Molecular Formula | C28H19N3O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [4-[3-(4-cyanatophenyl)-2-phenyl-1,2-dihydroindol-3-yl]phenyl] cyanate |
| SMILES | N#COc1ccc(C2(c3ccc(OC#N)cc3)c3ccccc3NC2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H19N3O2/c29-18-32-23-14-10-21(11-15-23)28(22-12-16-24(17-13-22)33-19-30)25-8-4-5-9-26(25)31-27(28)20-6-2-1-3-7-20/h1-17,27,31H |
| InChIKey | AFESTADXJPTEQF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|