C16H17N — CID 102592929
(2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole (PubChem CID 102592929) has the molecular formula C16H17N and a molecular weight of 224.33 g/mol. Its IUPAC name is (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole.
| Compound Name | (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole |
|---|---|
| PubChem CID | 102592929 |
| Molecular Formula | C16H17N |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole |
| SMILES | [2H][C@@]1(c2ccccc2)Nc2ccccc2C1(C)C |
| InChI | InChI=1S/C16H17N/c1-16(2)13-10-6-7-11-14(13)17-15(16)12-8-4-3-5-9-12/h3-11,15,17H,1-2H3/t15-/m0/s1/i15D |
| InChIKey | GBOHOKPJIMHHAH-IPAYDBEPSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |