About (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole
(2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole (PubChem CID 102592929) has the molecular formula C16H17N
and a molecular weight of 224.33 g/mol. Its IUPAC name is (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole.
Molecular Properties
| Compound Name | (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole |
| PubChem CID | 102592929 |
| Molecular Formula | C16H17N |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole |
| SMILES | [2H][C@@]1(c2ccccc2)Nc2ccccc2C1(C)C |
| InChI | InChI=1S/C16H17N/c1-16(2)13-10-6-7-11-14(13)17-15(16)12-8-4-3-5-9-12/h3-11,15,17H,1-2H3/t15-/m0/s1/i15D |
| InChIKey | GBOHOKPJIMHHAH-IPAYDBEPSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole?
The IUPAC name of (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole (CID 102592929) is (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole.
What is the SMILES notation for (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole?
The canonical SMILES for (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole is [2H][C@@]1(c2ccccc2)Nc2ccccc2C1(C)C.
What is the InChIKey of (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole?
The InChIKey is GBOHOKPJIMHHAH-IPAYDBEPSA-N. The full InChI is InChI=1S/C16H17N/c1-16(2)13-10-6-7-11-14(13)17-15(16)12-8-4-3-5-9-12/h3-11,15,17H,1-2H3/t15-/m0/s1/i15D.
What are the key properties of (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole?
(2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole has a molecular weight of 224.33 g/mol, XLogP of 4.13, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-deuterio-3,3-dimethyl-2-phenyl-1H-indole is sourced from PubChem (CID 102592929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).