C16H17NO — CID 141026444
3,3-dimethyl-2-phenyl-1,2-dihydroindol-5-ol (PubChem CID 141026444) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 3,3-dimethyl-2-phenyl-1,2-dihydroindol-5-ol.
| Compound Name | 3,3-dimethyl-2-phenyl-1,2-dihydroindol-5-ol |
|---|---|
| PubChem CID | 141026444 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3,3-dimethyl-2-phenyl-1,2-dihydroindol-5-ol |
| SMILES | CC1(C)c2cc(O)ccc2NC1c1ccccc1 |
| InChI | InChI=1S/C16H17NO/c1-16(2)13-10-12(18)8-9-14(13)17-15(16)11-6-4-3-5-7-11/h3-10,15,17-18H,1-2H3 |
| InChIKey | APCVOQLCJKVRBK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|