C26H24O — CID 177414444
(1S,8R,15S,22R)-1,8,15,22-tetramethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9,11,13,16,18,20-nonaen-4-ol (PubChem CID 177414444) has the molecular formula C26H24O and a molecular weight of 352.48 g/mol. Its IUPAC name is (1S,8R,15S,22R)-1,8,15,22-tetramethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9,11,13,16,18,20-nonaen-4-ol.
| Compound Name | (1S,8R,15S,22R)-1,8,15,22-tetramethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9,11,13,16,18,20-nonaen-4-ol |
|---|---|
| PubChem CID | 177414444 |
| Molecular Formula | C26H24O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (1S,8R,15S,22R)-1,8,15,22-tetramethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9,11,13,16,18,20-nonaen-4-ol |
| SMILES | C[C@]12c3ccccc3[C@]3(C)c4ccc(O)cc4[C@](C)(c4ccccc41)[C@]23C |
| InChI | InChI=1S/C26H24O/c1-23-17-9-5-6-10-18(17)24(2)21-14-13-16(27)15-22(21)25(3,26(23,24)4)20-12-8-7-11-19(20)23/h5-15,27H,1-4H3/t23-,24+,25-,26+/m0/s1 |
| InChIKey | CVAQARKNZVXOLH-ROXDYWFKSA-N |
| XLogP | 5.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |