C25H18O4 — CID 137364137
2-[9-(2,5-dihydroxyphenyl)fluoren-9-yl]benzene-1,4-diol (PubChem CID 137364137) has the molecular formula C25H18O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-[9-(2,5-dihydroxyphenyl)fluoren-9-yl]benzene-1,4-diol.
| Compound Name | 2-[9-(2,5-dihydroxyphenyl)fluoren-9-yl]benzene-1,4-diol |
|---|---|
| PubChem CID | 137364137 |
| Molecular Formula | C25H18O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[9-(2,5-dihydroxyphenyl)fluoren-9-yl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(C2(c3cc(O)ccc3O)c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C25H18O4/c26-15-9-11-23(28)21(13-15)25(22-14-16(27)10-12-24(22)29)19-7-3-1-5-17(19)18-6-2-4-8-20(18)25/h1-14,26-29H |
| InChIKey | OHDWKGBZEXXFQV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|