C25H16O4S — CID 171721504
10',10'-dioxospiro[fluorene-9,9'-thioxanthene]-2,7-diol (PubChem CID 171721504) has the molecular formula C25H16O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 10',10'-dioxospiro[fluorene-9,9'-thioxanthene]-2,7-diol.
| Compound Name | 10',10'-dioxospiro[fluorene-9,9'-thioxanthene]-2,7-diol |
|---|---|
| PubChem CID | 171721504 |
| Molecular Formula | C25H16O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 10',10'-dioxospiro[fluorene-9,9'-thioxanthene]-2,7-diol |
| SMILES | O=S1(=O)c2ccccc2C2(c3cc(O)ccc3-c3ccc(O)cc32)c2ccccc21 |
| InChI | InChI=1S/C25H16O4S/c26-15-9-11-17-18-12-10-16(27)14-22(18)25(21(17)13-15)19-5-1-3-7-23(19)30(28,29)24-8-4-2-6-20(24)25/h1-14,26-27H |
| InChIKey | BKBZVNDZALWLQG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |