C25H18O6 — CID 137364150
5-[9-(2,4,5-trihydroxyphenyl)fluoren-9-yl]benzene-1,2,4-triol (PubChem CID 137364150) has the molecular formula C25H18O6 and a molecular weight of 414.41 g/mol. Its IUPAC name is 5-[9-(2,4,5-trihydroxyphenyl)fluoren-9-yl]benzene-1,2,4-triol.
| Compound Name | 5-[9-(2,4,5-trihydroxyphenyl)fluoren-9-yl]benzene-1,2,4-triol |
|---|---|
| PubChem CID | 137364150 |
| Molecular Formula | C25H18O6 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 5-[9-(2,4,5-trihydroxyphenyl)fluoren-9-yl]benzene-1,2,4-triol |
| SMILES | Oc1cc(O)c(C2(c3cc(O)c(O)cc3O)c3ccccc3-c3ccccc32)cc1O |
| InChI | InChI=1S/C25H18O6/c26-19-11-23(30)21(28)9-17(19)25(18-10-22(29)24(31)12-20(18)27)15-7-3-1-5-13(15)14-6-2-4-8-16(14)25/h1-12,26-31H |
| InChIKey | VSYATHNGYDQYDG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|