C27H20N2O6 — CID 144999063
3,3'-dinitro-9,9'-spirobi[fluorene]-2,2'-diol;ethane (PubChem CID 144999063) has the molecular formula C27H20N2O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is 3,3'-dinitro-9,9'-spirobi[fluorene]-2,2'-diol;ethane.
| Compound Name | 3,3'-dinitro-9,9'-spirobi[fluorene]-2,2'-diol;ethane |
|---|---|
| PubChem CID | 144999063 |
| Molecular Formula | C27H20N2O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 3,3'-dinitro-9,9'-spirobi[fluorene]-2,2'-diol;ethane |
| SMILES | CC.O=[N+]([O-])c1cc2c(cc1O)C1(c3ccccc3-2)c2ccccc2-c2cc([N+](=O)[O-])c(O)cc21 |
| InChI | InChI=1S/C25H14N2O6.C2H6/c28-23-11-19-15(9-21(23)26(30)31)13-5-1-3-7-17(13)25(19)18-8-4-2-6-14(18)16-10-22(27(32)33)24(29)12-20(16)25;1-2/h1-12,28-29H;1-2H3 |
| InChIKey | VRZZQXBMNVICLF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|