C31H21NO3 — CID 163412438
3-(2-nitrophenyl)-9,9-diphenylfluoren-2-ol (PubChem CID 163412438) has the molecular formula C31H21NO3 and a molecular weight of 455.51 g/mol. Its IUPAC name is 3-(2-nitrophenyl)-9,9-diphenylfluoren-2-ol.
| Compound Name | 3-(2-nitrophenyl)-9,9-diphenylfluoren-2-ol |
|---|---|
| PubChem CID | 163412438 |
| Molecular Formula | C31H21NO3 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 3-(2-nitrophenyl)-9,9-diphenylfluoren-2-ol |
| SMILES | O=[N+]([O-])c1ccccc1-c1cc2c(cc1O)C(c1ccccc1)(c1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C31H21NO3/c33-30-20-28-25(19-26(30)24-16-8-10-18-29(24)32(34)35)23-15-7-9-17-27(23)31(28,21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-20,33H |
| InChIKey | ABPDWWYOYWIGIQ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|