C25H16BrNO2 — CID 177370574
4-bromo-3-nitro-9,9-diphenylfluorene (PubChem CID 177370574) has the molecular formula C25H16BrNO2 and a molecular weight of 442.31 g/mol. Its IUPAC name is 4-bromo-3-nitro-9,9-diphenylfluorene.
| Compound Name | 4-bromo-3-nitro-9,9-diphenylfluorene |
|---|---|
| PubChem CID | 177370574 |
| Molecular Formula | C25H16BrNO2 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 4-bromo-3-nitro-9,9-diphenylfluorene |
| SMILES | O=[N+]([O-])c1ccc2c(c1Br)-c1ccccc1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H16BrNO2/c26-24-22(27(28)29)16-15-21-23(24)19-13-7-8-14-20(19)25(21,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-16H |
| InChIKey | MUTCNQUABBFDPR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|