C25H16Br2O2 — CID 23496560
2-bromo-4-[9-(3-bromo-4-hydroxyphenyl)fluoren-9-yl]phenol (PubChem CID 23496560) has the molecular formula C25H16Br2O2 and a molecular weight of 508.21 g/mol. Its IUPAC name is 2-bromo-4-[9-(3-bromo-4-hydroxyphenyl)fluoren-9-yl]phenol.
| Compound Name | 2-bromo-4-[9-(3-bromo-4-hydroxyphenyl)fluoren-9-yl]phenol |
|---|---|
| PubChem CID | 23496560 |
| Molecular Formula | C25H16Br2O2 |
| Molecular Weight | 508.21 g/mol |
| Exact Mass | 505.95 |
| IUPAC Name | 2-bromo-4-[9-(3-bromo-4-hydroxyphenyl)fluoren-9-yl]phenol |
| SMILES | Oc1ccc(C2(c3ccc(O)c(Br)c3)c3ccccc3-c3ccccc32)cc1Br |
| InChI | InChI=1S/C25H16Br2O2/c26-21-13-15(9-11-23(21)28)25(16-10-12-24(29)22(27)14-16)19-7-3-1-5-17(19)18-6-2-4-8-20(18)25/h1-14,28-29H |
| InChIKey | ZKTNABJAOZQJCM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.21 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |