C25H16Br4N2 — CID 141181007
4-[9-(4-amino-3,5-dibromophenyl)fluoren-9-yl]-2,6-dibromoaniline (PubChem CID 141181007) has the molecular formula C25H16Br4N2 and a molecular weight of 664.03 g/mol. Its IUPAC name is 4-[9-(4-amino-3,5-dibromophenyl)fluoren-9-yl]-2,6-dibromoaniline.
| Compound Name | 4-[9-(4-amino-3,5-dibromophenyl)fluoren-9-yl]-2,6-dibromoaniline |
|---|---|
| PubChem CID | 141181007 |
| Molecular Formula | C25H16Br4N2 |
| Molecular Weight | 664.03 g/mol |
| Exact Mass | 659.80 |
| IUPAC Name | 4-[9-(4-amino-3,5-dibromophenyl)fluoren-9-yl]-2,6-dibromoaniline |
| SMILES | Nc1c(Br)cc(C2(c3cc(Br)c(N)c(Br)c3)c3ccccc3-c3ccccc32)cc1Br |
| InChI | InChI=1S/C25H16Br4N2/c26-19-9-13(10-20(27)23(19)30)25(14-11-21(28)24(31)22(29)12-14)17-7-3-1-5-15(17)16-6-2-4-8-18(16)25/h1-12H,30-31H2 |
| InChIKey | FOCQMWRJQICTBR-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.03 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|