C31H22Br4O4 — CID 141256278
[2,6-dibromo-4-[9-(3,5-dibromo-4-propanoyloxyphenyl)fluoren-9-yl]phenyl] propanoate (PubChem CID 141256278) has the molecular formula C31H22Br4O4 and a molecular weight of 778.13 g/mol. Its IUPAC name is [2,6-dibromo-4-[9-(3,5-dibromo-4-propanoyloxyphenyl)fluoren-9-yl]phenyl] propanoate.
| Compound Name | [2,6-dibromo-4-[9-(3,5-dibromo-4-propanoyloxyphenyl)fluoren-9-yl]phenyl] propanoate |
|---|---|
| PubChem CID | 141256278 |
| Molecular Formula | C31H22Br4O4 |
| Molecular Weight | 778.13 g/mol |
| Exact Mass | 773.83 |
| IUPAC Name | [2,6-dibromo-4-[9-(3,5-dibromo-4-propanoyloxyphenyl)fluoren-9-yl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(Br)cc(C2(c3cc(Br)c(OC(=O)CC)c(Br)c3)c3ccccc3-c3ccccc32)cc1Br |
| InChI | InChI=1S/C31H22Br4O4/c1-3-27(36)38-29-23(32)13-17(14-24(29)33)31(18-15-25(34)30(26(35)16-18)39-28(37)4-2)21-11-7-5-9-19(21)20-10-6-8-12-22(20)31/h5-16H,3-4H2,1-2H3 |
| InChIKey | JJULOCGRECMILA-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.13 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|