C29H26O4 — CID 154338119
2-ethyl-4-[9-(3-ethyl-2,4-dihydroxyphenyl)fluoren-9-yl]benzene-1,3-diol (PubChem CID 154338119) has the molecular formula C29H26O4 and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-ethyl-4-[9-(3-ethyl-2,4-dihydroxyphenyl)fluoren-9-yl]benzene-1,3-diol.
| Compound Name | 2-ethyl-4-[9-(3-ethyl-2,4-dihydroxyphenyl)fluoren-9-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 154338119 |
| Molecular Formula | C29H26O4 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-ethyl-4-[9-(3-ethyl-2,4-dihydroxyphenyl)fluoren-9-yl]benzene-1,3-diol |
| SMILES | CCc1c(O)ccc(C2(c3ccc(O)c(CC)c3O)c3ccccc3-c3ccccc32)c1O |
| InChI | InChI=1S/C29H26O4/c1-3-17-25(30)15-13-23(27(17)32)29(24-14-16-26(31)18(4-2)28(24)33)21-11-7-5-9-19(21)20-10-6-8-12-22(20)29/h5-16,30-33H,3-4H2,1-2H3 |
| InChIKey | MCIBDXOFUWUNSF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |