C29H26O2 — CID 139903469
6-[9-(2-hydroxy-3,4-dimethylphenyl)fluoren-9-yl]-2,3-dimethylphenol (PubChem CID 139903469) has the molecular formula C29H26O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 6-[9-(2-hydroxy-3,4-dimethylphenyl)fluoren-9-yl]-2,3-dimethylphenol.
| Compound Name | 6-[9-(2-hydroxy-3,4-dimethylphenyl)fluoren-9-yl]-2,3-dimethylphenol |
|---|---|
| PubChem CID | 139903469 |
| Molecular Formula | C29H26O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 6-[9-(2-hydroxy-3,4-dimethylphenyl)fluoren-9-yl]-2,3-dimethylphenol |
| SMILES | Cc1ccc(C2(c3ccc(C)c(C)c3O)c3ccccc3-c3ccccc32)c(O)c1C |
| InChI | InChI=1S/C29H26O2/c1-17-13-15-25(27(30)19(17)3)29(26-16-14-18(2)20(4)28(26)31)23-11-7-5-9-21(23)22-10-6-8-12-24(22)29/h5-16,30-31H,1-4H3 |
| InChIKey | CADLASBPVKZISO-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |