C25H14Cl4O2 — CID 142692075
2,6-dichloro-3-[9-(2,4-dichloro-3-hydroxyphenyl)fluoren-9-yl]phenol (PubChem CID 142692075) has the molecular formula C25H14Cl4O2 and a molecular weight of 488.20 g/mol. Its IUPAC name is 2,6-dichloro-3-[9-(2,4-dichloro-3-hydroxyphenyl)fluoren-9-yl]phenol.
| Compound Name | 2,6-dichloro-3-[9-(2,4-dichloro-3-hydroxyphenyl)fluoren-9-yl]phenol |
|---|---|
| PubChem CID | 142692075 |
| Molecular Formula | C25H14Cl4O2 |
| Molecular Weight | 488.20 g/mol |
| Exact Mass | 485.97 |
| IUPAC Name | 2,6-dichloro-3-[9-(2,4-dichloro-3-hydroxyphenyl)fluoren-9-yl]phenol |
| SMILES | Oc1c(Cl)ccc(C2(c3ccc(Cl)c(O)c3Cl)c3ccccc3-c3ccccc32)c1Cl |
| InChI | InChI=1S/C25H14Cl4O2/c26-19-11-9-17(21(28)23(19)30)25(18-10-12-20(27)24(31)22(18)29)15-7-3-1-5-13(15)14-6-2-4-8-16(14)25/h1-12,30-31H |
| InChIKey | COUBPTQZJKVFEE-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.20 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |