C31H22O9 — CID 172681217
4-[9-(2,3,4-trihydroxyphenyl)-1-(3,4,5-trihydroxyphenyl)fluoren-9-yl]benzene-1,2,3-triol (PubChem CID 172681217) has the molecular formula C31H22O9 and a molecular weight of 538.51 g/mol. Its IUPAC name is 4-[9-(2,3,4-trihydroxyphenyl)-1-(3,4,5-trihydroxyphenyl)fluoren-9-yl]benzene-1,2,3-triol.
| Compound Name | 4-[9-(2,3,4-trihydroxyphenyl)-1-(3,4,5-trihydroxyphenyl)fluoren-9-yl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 172681217 |
| Molecular Formula | C31H22O9 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 4-[9-(2,3,4-trihydroxyphenyl)-1-(3,4,5-trihydroxyphenyl)fluoren-9-yl]benzene-1,2,3-triol |
| SMILES | Oc1cc(-c2cccc3c2C(c2ccc(O)c(O)c2O)(c2ccc(O)c(O)c2O)c2ccccc2-3)cc(O)c1O |
| InChI | InChI=1S/C31H22O9/c32-21-10-8-19(26(36)29(21)39)31(20-9-11-22(33)30(40)27(20)37)18-7-2-1-4-16(18)17-6-3-5-15(25(17)31)14-12-23(34)28(38)24(35)13-14/h1-13,32-40H |
| InChIKey | AKQQLHDLZMPNNQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|