C18H21NO — CID 12982738
4-methoxy-3,3-dimethyl-2-phenyl-2,4-dihydro-1H-quinoline (PubChem CID 12982738) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-methoxy-3,3-dimethyl-2-phenyl-2,4-dihydro-1H-quinoline.
| Compound Name | 4-methoxy-3,3-dimethyl-2-phenyl-2,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 12982738 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-methoxy-3,3-dimethyl-2-phenyl-2,4-dihydro-1H-quinoline |
| SMILES | COC1c2ccccc2NC(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C18H21NO/c1-18(2)16(13-9-5-4-6-10-13)19-15-12-8-7-11-14(15)17(18)20-3/h4-12,16-17,19H,1-3H3 |
| InChIKey | JZURANJZOXJWRN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |