C20H22FNO3 — CID 787374
[(2S,4S)-2-(4-fluorophenyl)-6-methoxy-3,3-dimethyl-2,4-dihydro-1H-quinolin-4-yl] acetate (PubChem CID 787374) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is [(2S,4S)-2-(4-fluorophenyl)-6-methoxy-3,3-dimethyl-2,4-dihydro-1H-quinolin-4-yl] acetate.
| Compound Name | [(2S,4S)-2-(4-fluorophenyl)-6-methoxy-3,3-dimethyl-2,4-dihydro-1H-quinolin-4-yl] acetate |
|---|---|
| PubChem CID | 787374 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [(2S,4S)-2-(4-fluorophenyl)-6-methoxy-3,3-dimethyl-2,4-dihydro-1H-quinolin-4-yl] acetate |
| SMILES | COc1ccc2c(c1)[C@@H](OC(C)=O)C(C)(C)[C@H](c1ccc(F)cc1)N2 |
| InChI | InChI=1S/C20H22FNO3/c1-12(23)25-19-16-11-15(24-4)9-10-17(16)22-18(20(19,2)3)13-5-7-14(21)8-6-13/h5-11,18-19,22H,1-4H3/t18-,19+/m0/s1 |
| InChIKey | DSAQHSCMMOOKBN-RBUKOAKNSA-N |
| XLogP | 4.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|