C12H13NO4 — CID 79730196
2-(5-methoxy-2-oxo-1,3-dihydroindol-3-yl)propanoic acid (PubChem CID 79730196) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-(5-methoxy-2-oxo-1,3-dihydroindol-3-yl)propanoic acid.
| Compound Name | 2-(5-methoxy-2-oxo-1,3-dihydroindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 79730196 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-(5-methoxy-2-oxo-1,3-dihydroindol-3-yl)propanoic acid |
| SMILES | COc1ccc2c(c1)C(C(C)C(=O)O)C(=O)N2 |
| InChI | InChI=1S/C12H13NO4/c1-6(12(15)16)10-8-5-7(17-2)3-4-9(8)13-11(10)14/h3-6,10H,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | LWLOSQNDCLOLES-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |