C11H11NO4 — CID 20701063
2-acetyl-7-methoxy-4H-1,4-benzoxazin-3-one (PubChem CID 20701063) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-acetyl-7-methoxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-acetyl-7-methoxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 20701063 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-acetyl-7-methoxy-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccc2c(c1)OC(C(C)=O)C(=O)N2 |
| InChI | InChI=1S/C11H11NO4/c1-6(13)10-11(14)12-8-4-3-7(15-2)5-9(8)16-10/h3-5,10H,1-2H3,(H,12,14) |
| InChIKey | XYJMMRKRRFXVQX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|