About 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one
2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 116990407) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one.
Molecular Properties
| Compound Name | 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| PubChem CID | 116990407 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CC(=O)C1Oc2cccnc2NC1=O |
| InChI | InChI=1S/C9H8N2O3/c1-5(12)7-9(13)11-8-6(14-7)3-2-4-10-8/h2-4,7H,1H3,(H,10,11,13) |
| InChIKey | NRTWEFYDMIEXBD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one?
The IUPAC name of 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (CID 116990407) is 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one.
What is the SMILES notation for 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one?
The canonical SMILES for 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one is CC(=O)C1Oc2cccnc2NC1=O.
What is the InChIKey of 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one?
The InChIKey is NRTWEFYDMIEXBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c1-5(12)7-9(13)11-8-6(14-7)3-2-4-10-8/h2-4,7H,1H3,(H,10,11,13).
What are the key properties of 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one?
2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one has a molecular weight of 192.17 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-4H-pyrido[3,2-b][1,4]oxazin-3-one is sourced from PubChem (CID 116990407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).