C8H6N2O4 — CID 22036235
3-oxo-4H-pyrido[3,2-b][1,4]oxazine-2-carboxylic acid (PubChem CID 22036235) has the molecular formula C8H6N2O4 and a molecular weight of 194.15 g/mol. Its IUPAC name is 3-oxo-4H-pyrido[3,2-b][1,4]oxazine-2-carboxylic acid.
| Compound Name | 3-oxo-4H-pyrido[3,2-b][1,4]oxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 22036235 |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 3-oxo-4H-pyrido[3,2-b][1,4]oxazine-2-carboxylic acid |
| SMILES | O=C(O)C1Oc2cccnc2NC1=O |
| InChI | InChI=1S/C8H6N2O4/c11-7-5(8(12)13)14-4-2-1-3-9-6(4)10-7/h1-3,5H,(H,12,13)(H,9,10,11) |
| InChIKey | KWOTYHZJWRBURR-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|