C9H11N3O2 — CID 116990341
2-(2-aminoethyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 116990341) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-(2-aminoethyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 2-(2-aminoethyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 116990341 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-(2-aminoethyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | NCCC1Oc2cccnc2NC1=O |
| InChI | InChI=1S/C9H11N3O2/c10-4-3-7-9(13)12-8-6(14-7)2-1-5-11-8/h1-2,5,7H,3-4,10H2,(H,11,12,13) |
| InChIKey | VJTUYTWWBHAMHD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |