C18H18N2O5 — CID 17392422
2,4-dimethoxy-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)benzamide (PubChem CID 17392422) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)benzamide.
| Compound Name | 2,4-dimethoxy-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)benzamide |
|---|---|
| PubChem CID | 17392422 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2,4-dimethoxy-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)NC(=O)C(C)O3)c(OC)c1 |
| InChI | InChI=1S/C18H18N2O5/c1-10-17(21)20-14-8-11(4-7-15(14)25-10)19-18(22)13-6-5-12(23-2)9-16(13)24-3/h4-10H,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | URQLUSVXIIVSEO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |