C11H10O5 — CID 163210728
7-methoxy-3-oxo-4H-chromene-2-carboxylic acid (PubChem CID 163210728) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is 7-methoxy-3-oxo-4H-chromene-2-carboxylic acid.
| Compound Name | 7-methoxy-3-oxo-4H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 163210728 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 7-methoxy-3-oxo-4H-chromene-2-carboxylic acid |
| SMILES | COc1ccc2c(c1)OC(C(=O)O)C(=O)C2 |
| InChI | InChI=1S/C11H10O5/c1-15-7-3-2-6-4-8(12)10(11(13)14)16-9(6)5-7/h2-3,5,10H,4H2,1H3,(H,13,14) |
| InChIKey | MSJOHTUCGQIYNL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|