C13H14O2 — CID 151601541
6-(hydroxymethyl)-6-phenylcyclohexa-2,4-dien-1-ol (PubChem CID 151601541) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 6-(hydroxymethyl)-6-phenylcyclohexa-2,4-dien-1-ol.
| Compound Name | 6-(hydroxymethyl)-6-phenylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 151601541 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 6-(hydroxymethyl)-6-phenylcyclohexa-2,4-dien-1-ol |
| SMILES | OCC1(c2ccccc2)C=CC=CC1O |
| InChI | InChI=1S/C13H14O2/c14-10-13(9-5-4-8-12(13)15)11-6-2-1-3-7-11/h1-9,12,14-15H,10H2 |
| InChIKey | QKPAYUMWXCYZQD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |