C17H17NO — CID 161367393
6-benzyl-6-(1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 161367393) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 6-benzyl-6-(1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 6-benzyl-6-(1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 161367393 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 6-benzyl-6-(1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | OC1C=CC=CC1(Cc1ccccc1)c1ccc[nH]1 |
| InChI | InChI=1S/C17H17NO/c19-16-10-4-5-11-17(16,15-9-6-12-18-15)13-14-7-2-1-3-8-14/h1-12,16,18-19H,13H2 |
| InChIKey | SDMFFTMZWGZQES-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |