C23H29P — CID 141415068
benzyl-bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)phosphane (PubChem CID 141415068) has the molecular formula C23H29P and a molecular weight of 336.46 g/mol. Its IUPAC name is benzyl-bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)phosphane.
| Compound Name | benzyl-bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)phosphane |
|---|---|
| PubChem CID | 141415068 |
| Molecular Formula | C23H29P |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | benzyl-bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)phosphane |
| SMILES | CC1C=CC=CC1(C)P(Cc1ccccc1)C1(C)C=CC=CC1C |
| InChI | InChI=1S/C23H29P/c1-19-12-8-10-16-22(19,3)24(18-21-14-6-5-7-15-21)23(4)17-11-9-13-20(23)2/h5-17,19-20H,18H2,1-4H3 |
| InChIKey | HUASQMUFEMEPKC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|