C18H24O2 — CID 87513439
2-(1-hexyl-6-hydroxycyclohexa-2,4-dien-1-yl)phenol (PubChem CID 87513439) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-(1-hexyl-6-hydroxycyclohexa-2,4-dien-1-yl)phenol.
| Compound Name | 2-(1-hexyl-6-hydroxycyclohexa-2,4-dien-1-yl)phenol |
|---|---|
| PubChem CID | 87513439 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-(1-hexyl-6-hydroxycyclohexa-2,4-dien-1-yl)phenol |
| SMILES | CCCCCCC1(c2ccccc2O)C=CC=CC1O |
| InChI | InChI=1S/C18H24O2/c1-2-3-4-8-13-18(14-9-7-12-17(18)20)15-10-5-6-11-16(15)19/h5-7,9-12,14,17,19-20H,2-4,8,13H2,1H3 |
| InChIKey | DIXFSVAFYUIXAC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|