C22H23NO — CID 175755614
[6-(4-aminophenyl)-6-propylcyclohexa-2,4-dien-1-yl]-phenylmethanone (PubChem CID 175755614) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is [6-(4-aminophenyl)-6-propylcyclohexa-2,4-dien-1-yl]-phenylmethanone.
| Compound Name | [6-(4-aminophenyl)-6-propylcyclohexa-2,4-dien-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 175755614 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | [6-(4-aminophenyl)-6-propylcyclohexa-2,4-dien-1-yl]-phenylmethanone |
| SMILES | CCCC1(c2ccc(N)cc2)C=CC=CC1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23NO/c1-2-15-22(18-11-13-19(23)14-12-18)16-7-6-10-20(22)21(24)17-8-4-3-5-9-17/h3-14,16,20H,2,15,23H2,1H3 |
| InChIKey | DJXKNSAOQPYJOX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|