C16H14O4 — CID 172708153
(6-benzoyl-1-hydroxycyclohexa-2,4-dien-1-yl) prop-2-enoate (PubChem CID 172708153) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is (6-benzoyl-1-hydroxycyclohexa-2,4-dien-1-yl) prop-2-enoate.
| Compound Name | (6-benzoyl-1-hydroxycyclohexa-2,4-dien-1-yl) prop-2-enoate |
|---|---|
| PubChem CID | 172708153 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (6-benzoyl-1-hydroxycyclohexa-2,4-dien-1-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(O)C=CC=CC1C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H14O4/c1-2-14(17)20-16(19)11-7-6-10-13(16)15(18)12-8-4-3-5-9-12/h2-11,13,19H,1H2 |
| InChIKey | DWMXEFHXTJCAMS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|