C19H22O2 — CID 160596200
(6-cyclohexyl-6-hydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone (PubChem CID 160596200) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (6-cyclohexyl-6-hydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone.
| Compound Name | (6-cyclohexyl-6-hydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 160596200 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (6-cyclohexyl-6-hydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1C=CC=CC1(O)C1CCCCC1 |
| InChI | InChI=1S/C19H22O2/c20-18(15-9-3-1-4-10-15)17-13-7-8-14-19(17,21)16-11-5-2-6-12-16/h1,3-4,7-10,13-14,16-17,21H,2,5-6,11-12H2 |
| InChIKey | RDQXSEDUSMYIAY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |