C25H30O2 — CID 159892140
cyclopentyl(phenyl)methanone;2-cyclopentyl-2-phenyloxirane (PubChem CID 159892140) has the molecular formula C25H30O2 and a molecular weight of 362.51 g/mol. Its IUPAC name is cyclopentyl(phenyl)methanone;2-cyclopentyl-2-phenyloxirane.
| Compound Name | cyclopentyl(phenyl)methanone;2-cyclopentyl-2-phenyloxirane |
|---|---|
| PubChem CID | 159892140 |
| Molecular Formula | C25H30O2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | cyclopentyl(phenyl)methanone;2-cyclopentyl-2-phenyloxirane |
| SMILES | O=C(c1ccccc1)C1CCCC1.c1ccc(C2(C3CCCC3)CO2)cc1 |
| InChI | InChI=1S/C13H16O.C12H14O/c1-2-6-11(7-3-1)13(10-14-13)12-8-4-5-9-12;13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,12H,4-5,8-10H2;1-3,6-7,11H,4-5,8-9H2 |
| InChIKey | NUWRZVCRZURQMT-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|