C20H22NO2+ — CID 139730836
2-[4-(cyclohexanecarbonyl)pyridin-1-ium-1-yl]-1-phenylethanone (PubChem CID 139730836) has the molecular formula C20H22NO2+ and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-[4-(cyclohexanecarbonyl)pyridin-1-ium-1-yl]-1-phenylethanone.
| Compound Name | 2-[4-(cyclohexanecarbonyl)pyridin-1-ium-1-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 139730836 |
| Molecular Formula | C20H22NO2+ |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[4-(cyclohexanecarbonyl)pyridin-1-ium-1-yl]-1-phenylethanone |
| SMILES | O=C(C[n+]1ccc(C(=O)C2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H22NO2/c22-19(16-7-3-1-4-8-16)15-21-13-11-18(12-14-21)20(23)17-9-5-2-6-10-17/h1,3-4,7-8,11-14,17H,2,5-6,9-10,15H2/q+1 |
| InChIKey | FKZIZFMOHMIFTH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|