C18H20NO2+ — CID 139732290
2,2-dimethyl-1-(1-phenacylpyridin-1-ium-4-yl)propan-1-one (PubChem CID 139732290) has the molecular formula C18H20NO2+ and a molecular weight of 282.36 g/mol. Its IUPAC name is 2,2-dimethyl-1-(1-phenacylpyridin-1-ium-4-yl)propan-1-one.
| Compound Name | 2,2-dimethyl-1-(1-phenacylpyridin-1-ium-4-yl)propan-1-one |
|---|---|
| PubChem CID | 139732290 |
| Molecular Formula | C18H20NO2+ |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2,2-dimethyl-1-(1-phenacylpyridin-1-ium-4-yl)propan-1-one |
| SMILES | CC(C)(C)C(=O)c1cc[n+](CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H20NO2/c1-18(2,3)17(21)15-9-11-19(12-10-15)13-16(20)14-7-5-4-6-8-14/h4-12H,13H2,1-3H3/q+1 |
| InChIKey | LDTAPUJPJKHTCR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|