C19H22NO+ — CID 139731685
2-(4-cyclohexylpyridin-1-ium-1-yl)-1-phenylethanone (PubChem CID 139731685) has the molecular formula C19H22NO+ and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-(4-cyclohexylpyridin-1-ium-1-yl)-1-phenylethanone.
| Compound Name | 2-(4-cyclohexylpyridin-1-ium-1-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 139731685 |
| Molecular Formula | C19H22NO+ |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-(4-cyclohexylpyridin-1-ium-1-yl)-1-phenylethanone |
| SMILES | O=C(C[n+]1ccc(C2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H22NO/c21-19(18-9-5-2-6-10-18)15-20-13-11-17(12-14-20)16-7-3-1-4-8-16/h2,5-6,9-14,16H,1,3-4,7-8,15H2/q+1 |
| InChIKey | FQTXPCDQNITPSA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|