C15H16O4 — CID 67766538
(4-ethoxy-6,6-dihydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone (PubChem CID 67766538) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (4-ethoxy-6,6-dihydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone.
| Compound Name | (4-ethoxy-6,6-dihydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 67766538 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (4-ethoxy-6,6-dihydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone |
| SMILES | CCOC1=CC(O)(O)C(C(=O)c2ccccc2)C=C1 |
| InChI | InChI=1S/C15H16O4/c1-2-19-12-8-9-13(15(17,18)10-12)14(16)11-6-4-3-5-7-11/h3-10,13,17-18H,2H2,1H3 |
| InChIKey | VEPITWRZCPERGA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|