C29H30O7 — CID 66608147
(6,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-yl)-phenylmethanone;2-[hydroxy(phenyl)methylidene]-5-methoxy-5-methylcyclohex-3-en-1-one (PubChem CID 66608147) has the molecular formula C29H30O7 and a molecular weight of 490.55 g/mol. Its IUPAC name is (6,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-yl)-phenylmethanone;2-[hydroxy(phenyl)methylidene]-5-methoxy-5-methylcyclohex-3-en-1-one.
| Compound Name | (6,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-yl)-phenylmethanone;2-[hydroxy(phenyl)methylidene]-5-methoxy-5-methylcyclohex-3-en-1-one |
|---|---|
| PubChem CID | 66608147 |
| Molecular Formula | C29H30O7 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (6,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-yl)-phenylmethanone;2-[hydroxy(phenyl)methylidene]-5-methoxy-5-methylcyclohex-3-en-1-one |
| SMILES | COC1(C)C=CC(=C(O)c2ccccc2)C(=O)C1.COC1=CC(O)(O)C(C(=O)c2ccccc2)C=C1 |
| InChI | InChI=1S/C15H16O3.C14H14O4/c1-15(18-2)9-8-12(13(16)10-15)14(17)11-6-4-3-5-7-11;1-18-11-7-8-12(14(16,17)9-11)13(15)10-5-3-2-4-6-10/h3-9,17H,10H2,1-2H3;2-9,12,16-17H,1H3 |
| InChIKey | MYDTWHHJDDBBFN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|