C25H26O4 — CID 174765956
1-(5-benzoyl-6,6-diethoxycyclohexa-1,3-dien-1-yl)-2-phenylethanone (PubChem CID 174765956) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-(5-benzoyl-6,6-diethoxycyclohexa-1,3-dien-1-yl)-2-phenylethanone.
| Compound Name | 1-(5-benzoyl-6,6-diethoxycyclohexa-1,3-dien-1-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 174765956 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-(5-benzoyl-6,6-diethoxycyclohexa-1,3-dien-1-yl)-2-phenylethanone |
| SMILES | CCOC1(OCC)C(C(=O)Cc2ccccc2)=CC=CC1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26O4/c1-3-28-25(29-4-2)21(23(26)18-19-12-7-5-8-13-19)16-11-17-22(25)24(27)20-14-9-6-10-15-20/h5-17,22H,3-4,18H2,1-2H3 |
| InChIKey | PXQAKVVKJYBEMW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|