About (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone
(6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone (PubChem CID 67841823) has the molecular formula C15H15FO3
and a molecular weight of 262.28 g/mol. Its IUPAC name is (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone |
| PubChem CID | 67841823 |
| Molecular Formula | C15H15FO3 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone |
| SMILES | COC1=CC(F)(OC)C(C(=O)c2ccccc2)C=C1 |
| InChI | InChI=1S/C15H15FO3/c1-18-12-8-9-13(15(16,10-12)19-2)14(17)11-6-4-3-5-7-11/h3-10,13H,1-2H3 |
| InChIKey | XERPADGUZLPQEV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone?
The IUPAC name of (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone (CID 67841823) is (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone.
What is the SMILES notation for (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone?
The canonical SMILES for (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone is COC1=CC(F)(OC)C(C(=O)c2ccccc2)C=C1.
What is the InChIKey of (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone?
The InChIKey is XERPADGUZLPQEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FO3/c1-18-12-8-9-13(15(16,10-12)19-2)14(17)11-6-4-3-5-7-11/h3-10,13H,1-2H3.
What are the key properties of (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone?
(6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone has a molecular weight of 262.28 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-4,6-dimethoxycyclohexa-2,4-dien-1-yl)-phenylmethanone is sourced from PubChem (CID 67841823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).