C16H24O — CID 100998579
3-(2,2-dimethylpropyl)-3-methyl-1-phenylcyclobutan-1-ol (PubChem CID 100998579) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-3-methyl-1-phenylcyclobutan-1-ol.
| Compound Name | 3-(2,2-dimethylpropyl)-3-methyl-1-phenylcyclobutan-1-ol |
|---|---|
| PubChem CID | 100998579 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-3-methyl-1-phenylcyclobutan-1-ol |
| SMILES | CC(C)(C)CC1(C)CC(O)(c2ccccc2)C1 |
| InChI | InChI=1S/C16H24O/c1-14(2,3)10-15(4)11-16(17,12-15)13-8-6-5-7-9-13/h5-9,17H,10-12H2,1-4H3 |
| InChIKey | IILMUAJPADTJNL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |