C11H12Cl2O2 — CID 166443974
3,3-dichloro-2-phenyloxan-2-ol (PubChem CID 166443974) has the molecular formula C11H12Cl2O2 and a molecular weight of 247.12 g/mol. Its IUPAC name is 3,3-dichloro-2-phenyloxan-2-ol.
| Compound Name | 3,3-dichloro-2-phenyloxan-2-ol |
|---|---|
| PubChem CID | 166443974 |
| Molecular Formula | C11H12Cl2O2 |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 3,3-dichloro-2-phenyloxan-2-ol |
| SMILES | OC1(c2ccccc2)OCCCC1(Cl)Cl |
| InChI | InChI=1S/C11H12Cl2O2/c12-10(13)7-4-8-15-11(10,14)9-5-2-1-3-6-9/h1-3,5-6,14H,4,7-8H2 |
| InChIKey | KNCWMRRLBLZBTA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|