About bis(2-phenyl-1,3-dioxan-2-yl)methanone
bis(2-phenyl-1,3-dioxan-2-yl)methanone (PubChem CID 175026730) has the molecular formula C21H22O5
and a molecular weight of 354.40 g/mol. Its IUPAC name is bis(2-phenyl-1,3-dioxan-2-yl)methanone.
Molecular Properties
| Compound Name | bis(2-phenyl-1,3-dioxan-2-yl)methanone |
| PubChem CID | 175026730 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | bis(2-phenyl-1,3-dioxan-2-yl)methanone |
| SMILES | O=C(C1(c2ccccc2)OCCCO1)C1(c2ccccc2)OCCCO1 |
| InChI | InChI=1S/C21H22O5/c22-19(20(23-13-7-14-24-20)17-9-3-1-4-10-17)21(25-15-8-16-26-21)18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2 |
| InChIKey | NWFUHLSVORMBIR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(2-phenyl-1,3-dioxan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-phenyl-1,3-dioxan-2-yl)methanone?
The IUPAC name of bis(2-phenyl-1,3-dioxan-2-yl)methanone (CID 175026730) is bis(2-phenyl-1,3-dioxan-2-yl)methanone.
What is the SMILES notation for bis(2-phenyl-1,3-dioxan-2-yl)methanone?
The canonical SMILES for bis(2-phenyl-1,3-dioxan-2-yl)methanone is O=C(C1(c2ccccc2)OCCCO1)C1(c2ccccc2)OCCCO1.
What is the InChIKey of bis(2-phenyl-1,3-dioxan-2-yl)methanone?
The InChIKey is NWFUHLSVORMBIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O5/c22-19(20(23-13-7-14-24-20)17-9-3-1-4-10-17)21(25-15-8-16-26-21)18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2.
What are the key properties of bis(2-phenyl-1,3-dioxan-2-yl)methanone?
bis(2-phenyl-1,3-dioxan-2-yl)methanone has a molecular weight of 354.40 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-phenyl-1,3-dioxan-2-yl)methanone is sourced from PubChem (CID 175026730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).