C26H34O4 — CID 15361394
(1R,14R)-1,14-diphenyl-2,6,9,13-tetraoxabicyclo[12.4.0]octadecane (PubChem CID 15361394) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (1R,14R)-1,14-diphenyl-2,6,9,13-tetraoxabicyclo[12.4.0]octadecane.
| Compound Name | (1R,14R)-1,14-diphenyl-2,6,9,13-tetraoxabicyclo[12.4.0]octadecane |
|---|---|
| PubChem CID | 15361394 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (1R,14R)-1,14-diphenyl-2,6,9,13-tetraoxabicyclo[12.4.0]octadecane |
| SMILES | c1ccc([C@]23CCCC[C@]2(c2ccccc2)OCCCOCCOCCCO3)cc1 |
| InChI | InChI=1S/C26H34O4/c1-3-11-23(12-4-1)25-15-7-8-16-26(25,24-13-5-2-6-14-24)30-20-10-18-28-22-21-27-17-9-19-29-25/h1-6,11-14H,7-10,15-22H2/t25-,26-/m1/s1 |
| InChIKey | BBYORKKHFUUXBR-CLJLJLNGSA-N |
| XLogP | 5.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |