C25H34O7 — CID 12934420
2,2-diphenyl-1,3,6,9,12,15,18-heptaoxacycloicosane (PubChem CID 12934420) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is 2,2-diphenyl-1,3,6,9,12,15,18-heptaoxacycloicosane.
| Compound Name | 2,2-diphenyl-1,3,6,9,12,15,18-heptaoxacycloicosane |
|---|---|
| PubChem CID | 12934420 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 2,2-diphenyl-1,3,6,9,12,15,18-heptaoxacycloicosane |
| SMILES | c1ccc(C2(c3ccccc3)OCCOCCOCCOCCOCCOCCO2)cc1 |
| InChI | InChI=1S/C25H34O7/c1-3-7-23(8-4-1)25(24-9-5-2-6-10-24)31-21-19-29-17-15-27-13-11-26-12-14-28-16-18-30-20-22-32-25/h1-10H,11-22H2 |
| InChIKey | SUFRZWHTOSHECF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |