C16H16O2S — CID 15417317
2-phenyl-2-(phenylsulfanylmethyl)-1,3-dioxolane (PubChem CID 15417317) has the molecular formula C16H16O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-phenyl-2-(phenylsulfanylmethyl)-1,3-dioxolane.
| Compound Name | 2-phenyl-2-(phenylsulfanylmethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 15417317 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-phenyl-2-(phenylsulfanylmethyl)-1,3-dioxolane |
| SMILES | c1ccc(SCC2(c3ccccc3)OCCO2)cc1 |
| InChI | InChI=1S/C16H16O2S/c1-3-7-14(8-4-1)16(17-11-12-18-16)13-19-15-9-5-2-6-10-15/h1-10H,11-13H2 |
| InChIKey | XHTGVGRSARYNOU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |