C15H14OS — CID 11096799
2,2-diphenyl-1,3-oxathiolane (PubChem CID 11096799) has the molecular formula C15H14OS and a molecular weight of 242.34 g/mol. Its IUPAC name is 2,2-diphenyl-1,3-oxathiolane.
| Compound Name | 2,2-diphenyl-1,3-oxathiolane |
|---|---|
| PubChem CID | 11096799 |
| Molecular Formula | C15H14OS |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2,2-diphenyl-1,3-oxathiolane |
| SMILES | c1ccc(C2(c3ccccc3)OCCS2)cc1 |
| InChI | InChI=1S/C15H14OS/c1-3-7-13(8-4-1)15(16-11-12-17-15)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | YYVQRWLZGPYQEK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |