C17H18O2 — CID 142902155
2-(4-methylphenyl)-2-phenyl-1,4-dioxane (PubChem CID 142902155) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(4-methylphenyl)-2-phenyl-1,4-dioxane.
| Compound Name | 2-(4-methylphenyl)-2-phenyl-1,4-dioxane |
|---|---|
| PubChem CID | 142902155 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-(4-methylphenyl)-2-phenyl-1,4-dioxane |
| SMILES | Cc1ccc(C2(c3ccccc3)COCCO2)cc1 |
| InChI | InChI=1S/C17H18O2/c1-14-7-9-16(10-8-14)17(13-18-11-12-19-17)15-5-3-2-4-6-15/h2-10H,11-13H2,1H3 |
| InChIKey | BMNFYQPRNANDSO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |